EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H6N2O2 |
| Net Charge | 0 |
| Average Mass | 126.115 |
| Monoisotopic Mass | 126.04293 |
| SMILES | Cn1ccc(=O)nc1=O |
| InChI | InChI=1S/C5H6N2O2/c1-7-3-2-4(8)6-5(7)9/h2-3H,1H3,(H,6,8,9) |
| InChIKey | XBCXJKGHPABGSD-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cordyceps sinensis (ncbitaxon:72228) | mycelium (BTO:0001436) | PubMed (21848266) | Ethanolic extract of dried mycelia |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-methyluracil (CHEBI:69445) has functional parent uracil (CHEBI:17568) |
| 1-methyluracil (CHEBI:69445) has role metabolite (CHEBI:25212) |
| 1-methyluracil (CHEBI:69445) is a nucleobase analogue (CHEBI:67142) |
| 1-methyluracil (CHEBI:69445) is a pyrimidone (CHEBI:38337) |
| IUPAC Name |
|---|
| 1-methylpyrimidine-2,4(1H,3H)-dione |
| Registry Numbers | Sources |
|---|---|
| Reaxys:116505 | Reaxys |
| CAS:615-77-0 | ChemIDplus |
| Citations |
|---|