EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H12N2O4 |
| Net Charge | 0 |
| Average Mass | 308.293 |
| Monoisotopic Mass | 308.07971 |
| SMILES | O=C(O)c1cc2c(nc3ccccc32)c(-c2ccc(CO)o2)n1 |
| InChI | InChI=1S/C17H12N2O4/c20-8-9-5-6-14(23-9)16-15-11(7-13(19-16)17(21)22)10-3-1-2-4-12(10)18-15/h1-7,18,20H,8H2,(H,21,22) |
| InChIKey | USBWYUYKHHILLZ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cordyceps sinensis (ncbitaxon:72228) | mycelium (BTO:0001436) | PubMed (21848266) | Ethanolic extract of dried mycelia |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| flazin (CHEBI:69443) has role metabolite (CHEBI:25212) |
| flazin (CHEBI:69443) is a harmala alkaloid (CHEBI:61379) |
| Synonym | Source |
|---|---|
| 9H-Pyrido(3,4-b)indole-3-carboxylic acid, 1-(5-(hydroxymethyl)-2-furanyl)- | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0033459 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:100041-05-2 | ChemIDplus |
| Citations |
|---|