EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H8O2 |
| Net Charge | 0 |
| Average Mass | 124.139 |
| Monoisotopic Mass | 124.05243 |
| SMILES | COc1ccc(O)cc1 |
| InChI | InChI=1S/C7H8O2/c1-9-7-4-2-6(8)3-5-7/h2-5,8H,1H3 |
| InChIKey | NWVVVBRKAWDGAB-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cordyceps sinensis (ncbitaxon:72228) | mycelium (BTO:0001436) | PubMed (21848266) | Ethanolic extract of dried mycelia |
| Homo sapiens (ncbitaxon:9606) | |||
| - | MetaboLights (MTBLS226) | From MetaboLights | |
| - | MetaboLights (MTBLS150) | From MetaboLights |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| p-methoxyphenol (CHEBI:69441) has role metabolite (CHEBI:25212) |
| p-methoxyphenol (CHEBI:69441) is a methoxybenzenes (CHEBI:51683) |
| p-methoxyphenol (CHEBI:69441) is a phenols (CHEBI:33853) |
| Synonyms | Source |
|---|---|
| 1-Hydroxy-4-methoxybenzene | ChEBI |
| 4-Hydroxyanisole | ChEBI |
| 4-Methoxyphenol | ChEBI |
| p-Guaiacol | ChEBI |
| Mequinol | ChEBI |
| p-Hydroxyanisol | DrugCentral |
| UniProt Name | Source |
|---|---|
| 4-methoxyphenol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 0000150765 | ChemIDplus |
| 4221 | DrugCentral |
| HMDB0029696 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:150-76-5 | DrugCentral |
| Citations |
|---|