EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16N2O2 |
| Net Charge | 0 |
| Average Mass | 196.250 |
| Monoisotopic Mass | 196.12118 |
| SMILES | [H][C@@]12CCCN1C(=O)[C@H](C(C)C)NC2=O |
| InChI | InChI=1S/C10H16N2O2/c1-6(2)8-10(14)12-5-3-4-7(12)9(13)11-8/h6-8H,3-5H2,1-2H3,(H,11,13)/t7-,8-/m0/s1 |
| InChIKey | XLUAWXQORJEMBD-YUMQZZPRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cordyceps sinensis (ncbitaxon:72228) | mycelium (BTO:0001436) | PubMed (21848266) | Ethanolic extract of dried mycelia |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cyclo(L-Pro-L-Val) (CHEBI:69439) has role metabolite (CHEBI:25212) |
| cyclo(L-Pro-L-Val) (CHEBI:69439) is a piperazinone (CHEBI:46846) |
| Synonym | Source |
|---|---|
| (3S,8aS)-3-Isopropylhexahydropyrrolo[1,2-a]pyrazine-1,4-dione | ChEBI |
| Citations |
|---|