EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H50O |
| Net Charge | 0 |
| Average Mass | 426.729 |
| Monoisotopic Mass | 426.38617 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)CCC(=C)C(C)C)[C@@]1(C)CCC1=C2CC[C@@]2([H])C(C)(C)[C@@H](O)CC[C@]12C |
| InChI | InChI=1S/C30H50O/c1-19(2)20(3)9-10-21(4)23-12-13-24-22-11-14-26-28(5,6)27(31)16-18-30(26,8)25(22)15-17-29(23,24)7/h19,21,23-24,26-27,31H,3,9-18H2,1-2,4-8H3/t21-,23-,24+,26+,27+,29-,30-/m1/s1 |
| InChIKey | UEWBRSZKEWLYPN-IZSNWBDOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cordyceps sinensis (ncbitaxon:72228) | mycelium (BTO:0001436) | PubMed (21848266) | Ethanolic extract of dried mycelia |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4,4-dimethyl-5α-ergosta-8,24(28)-dien-3β-ol (CHEBI:69435) has role fungal metabolite (CHEBI:76946) |
| 4,4-dimethyl-5α-ergosta-8,24(28)-dien-3β-ol (CHEBI:69435) is a 3β-sterol (CHEBI:35348) |
| IUPAC Name |
|---|
| (5α)-4,4-dimethylergosta-8,24(28)-dien-3β-ol |
| Synonym | Source |
|---|---|
| 4,4-dimethylfecosterol | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5355066 | Reaxys |
| Citations |
|---|