EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H52O2 |
| Net Charge | 0 |
| Average Mass | 456.755 |
| Monoisotopic Mass | 456.39673 |
| SMILES | [H][C@@]12CC=C3C[C@@H](OC(C)=O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1([H])[C@H](C)CC[C@@H](CC)C(C)C |
| InChI | InChI=1S/C31H52O2/c1-8-23(20(2)3)10-9-21(4)27-13-14-28-26-12-11-24-19-25(33-22(5)32)15-17-30(24,6)29(26)16-18-31(27,28)7/h11,20-21,23,25-29H,8-10,12-19H2,1-7H3/t21-,23-,25+,26+,27-,28+,29+,30+,31-/m1/s1 |
| InChIKey | PBWOIPCULUXTNY-LBKBYZTLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cordyceps sinensis (ncbitaxon:72228) | mycelium (BTO:0001436) | PubMed (21848266) | EtOH extract of dried mycelia, mixture of beta-sitosterol 3-O-acetate and stigmasterol 3-O-acetate |
| Roles Classification |
|---|
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-sitosterol 3-O-acetate (CHEBI:69433) has functional parent sitosterol (CHEBI:27693) |
| β-sitosterol 3-O-acetate (CHEBI:69433) has parent hydride stigmastane (CHEBI:26773) |
| β-sitosterol 3-O-acetate (CHEBI:69433) has role fungal metabolite (CHEBI:76946) |
| β-sitosterol 3-O-acetate (CHEBI:69433) has role plant metabolite (CHEBI:76924) |
| β-sitosterol 3-O-acetate (CHEBI:69433) is a acetate ester (CHEBI:47622) |
| β-sitosterol 3-O-acetate (CHEBI:69433) is a steroid ester (CHEBI:47880) |
| IUPAC Name |
|---|
| stigmast-5-en-3β-yl acetate |
| Synonyms | Source |
|---|---|
| 3β-acetoxystigmast-5-ene | ChEBI |
| β-sitosterol acetate | HMDB |
| β-sitosteryl acetate | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0030151 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1916957 | Reaxys |
| CAS:915-05-9 | ChemIDplus |
| Citations |
|---|