EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H48O |
| Net Charge | 0 |
| Average Mass | 400.691 |
| Monoisotopic Mass | 400.37052 |
| SMILES | [H][C@@]12CC=C3[C@]([H])(CC[C@@]4(C)[C@@]3([H])CC[C@]4([H])[C@H](C)CC[C@H](C)C(C)C)[C@@]1(C)CC[C@H](O)C2 |
| InChI | InChI=1S/C28H48O/c1-18(2)19(3)7-8-20(4)24-11-12-25-23-10-9-21-17-22(29)13-15-27(21,5)26(23)14-16-28(24,25)6/h10,18-22,24-26,29H,7-9,11-17H2,1-6H3/t19-,20+,21-,22-,24+,25-,26-,27-,28+/m0/s1 |
| InChIKey | PUGBZUWUTZUUCP-ZRKHGVCBSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cordyceps sinensis (ncbitaxon:72228) | mycelium (BTO:0001436) | PubMed (21848266) | Ethanolic extract of dried mycelia |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fungisterol (CHEBI:69432) has role fungal metabolite (CHEBI:76946) |
| fungisterol (CHEBI:69432) is a 3β-hydroxy steroid (CHEBI:36836) |
| fungisterol (CHEBI:69432) is a ergostanoid (CHEBI:50403) |
| IUPAC Name |
|---|
| (5α)-ergost-7β-en-3-ol |
| Synonyms | Source |
|---|---|
| γ-ergostenol | ChemIDplus |
| Δ7-ergostenol | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Fungisterol | Wikipedia |
| LMST01030105 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3216965 | Reaxys |
| CAS:516-78-9 | ChemIDplus |
| Citations |
|---|