EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H40O |
| Net Charge | 0 |
| Average Mass | 392.627 |
| Monoisotopic Mass | 392.30792 |
| SMILES | [H][C@]12CC[C@@]3(C)C(=C1C=CC1=CC(=O)CC[C@@]12C)CC[C@]3([H])[C@H](C)/C=C/[C@H](C)C(C)C |
| InChI | InChI=1S/C28H40O/c1-18(2)19(3)7-8-20(4)24-11-12-25-23-10-9-21-17-22(29)13-15-27(21,5)26(23)14-16-28(24,25)6/h7-10,17-20,24,26H,11-16H2,1-6H3/b8-7+/t19-,20+,24+,26-,27-,28+/m0/s1 |
| InChIKey | OIMXTYUHMBQQJM-HSVWHVBGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus ochraceus (ncbitaxon:40380) | mycelium (BTO:0001436) | PubMed (21043476) | MeOH(mycelia) & EtOAc(broth) extract of an endophytic fungus isolated from Sargassum kjellmanianum Strain: EN 31 |
| Cordyceps sinensis (ncbitaxon:72228) | mycelium (BTO:0001436) | PubMed (21848266) | Ethanolic extract of dried mycelia |
| Penicillium commune (ncbitaxon:36653) | mycelium (BTO:0001436) | PubMed (21226488) | Methanolic extract of mycelia and ethyl acetate extract of culture broth Strain: QSD 17 |
| Xylaria (ncbitaxon:37991) | - | PubMed (21428374) | Endolichenic fungi isolated from Leptogium saturninum and EtOAc extract of fermented rice substrate |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ergosta-4,6,8(14),22-tetraen-3-one (CHEBI:69431) has role fungal metabolite (CHEBI:76946) |
| ergosta-4,6,8(14),22-tetraen-3-one (CHEBI:69431) is a 3-oxo-Δ4 steroid (CHEBI:47909) |
| ergosta-4,6,8(14),22-tetraen-3-one (CHEBI:69431) is a ergostanoid (CHEBI:50403) |
| IUPAC Name |
|---|
| (22E)-ergosta-4,6,8(14),22-tetraen-3-one |
| Synonym | Source |
|---|---|
| 24-methylcholesta-4,6,8(14),22-tetraen-3-one | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3223568 | Reaxys |
| CAS:19254-69-4 | ChemIDplus |
| Citations |
|---|