EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H34O3 |
| Net Charge | 0 |
| Average Mass | 346.511 |
| Monoisotopic Mass | 346.25079 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)/C=C/[C@H](C)C(C)C)[C@@]1(C)CC[C@]1(OC)OC(=O)C=C12 |
| InChI | InChI=1S/C22H34O3/c1-14(2)15(3)7-8-16(4)17-9-10-18-19-13-20(23)25-22(19,24-6)12-11-21(17,18)5/h7-8,13-18H,9-12H2,1-6H3/b8-7+/t15-,16+,17+,18-,21+,22-/m0/s1 |
| InChIKey | FCFUSYHGZLEMJM-IIVOHCRVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cordyceps sinensis (ncbitaxon:72228) | mycelium (BTO:0001436) | PubMed (21848266) | Ethanolic extract of dried mycelia |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (17R)-17-methylincisterol (CHEBI:69430) has role metabolite (CHEBI:25212) |
| (17R)-17-methylincisterol (CHEBI:69430) is a terpene lactone (CHEBI:37668) |
| Citations |
|---|