EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H14N2O2 |
| Net Charge | 0 |
| Average Mass | 242.278 |
| Monoisotopic Mass | 242.10553 |
| SMILES | OC[C@H](O)Cc1nccc2c1nc1ccccc12 |
| InChI | InChI=1S/C14H14N2O2/c17-8-9(18)7-13-14-11(5-6-15-13)10-3-1-2-4-12(10)16-14/h1-6,9,16-18H,7-8H2/t9-/m1/s1 |
| InChIKey | OYZWACRLCWKSSL-SECBINFHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cordyceps sinensis (ncbitaxon:72228) | mycelium (BTO:0001436) | PubMed (21848266) | Ethanolic extract of dried mycelia |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cordysinin E (CHEBI:69429) has parent hydride β-carboline (CHEBI:109895) |
| cordysinin E (CHEBI:69429) has role plant metabolite (CHEBI:76924) |
| cordysinin E (CHEBI:69429) is a diol (CHEBI:23824) |
| cordysinin E (CHEBI:69429) is a β-carbolines (CHEBI:60834) |
| IUPAC Name |
|---|
| (2R)-3-(9H-β-carbolin-1-yl)propane-1,2-diol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21902662 | Reaxys |
| Citations |
|---|