EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H12N2O |
| Net Charge | 0 |
| Average Mass | 212.252 |
| Monoisotopic Mass | 212.09496 |
| SMILES | C[C@@H](O)c1nccc2c1nc1ccccc12 |
| InChI | InChI=1S/C13H12N2O/c1-8(16)12-13-10(6-7-14-12)9-4-2-3-5-11(9)15-13/h2-8,15-16H,1H3/t8-/m1/s1 |
| InChIKey | GKXWQOGSNJJLKJ-MRVPVSSYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cordyceps sinensis (ncbitaxon:72228) | mycelium (BTO:0001436) | PubMed (21848266) | Ethanolic extract of dried mycelia |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cordysinin C (CHEBI:69427) has parent hydride β-carboline (CHEBI:109895) |
| cordysinin C (CHEBI:69427) has role fungal metabolite (CHEBI:76946) |
| cordysinin C (CHEBI:69427) is a secondary alcohol (CHEBI:35681) |
| cordysinin C (CHEBI:69427) is a β-carbolines (CHEBI:60834) |
| IUPAC Name |
|---|
| (1R)-1-(9H-β-carbolin-1-yl)ethanol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21902660 | Reaxys |
| Citations |
|---|