EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H15N5O4 |
| Net Charge | 0 |
| Average Mass | 281.272 |
| Monoisotopic Mass | 281.11240 |
| SMILES | CO[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C11H15N5O4/c1-19-8-7(18)5(2-17)20-11(8)16-4-15-6-9(12)13-3-14-10(6)16/h3-5,7-8,11,17-18H,2H2,1H3,(H2,12,13,14)/t5-,7-,8-,11-/m1/s1 |
| InChIKey | FPUGCISOLXNPPC-IOSLPCCCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cordyceps sinensis (ncbitaxon:72228) | mycelium (BTO:0001436) | PubMed (21848266) | Ethanolic extract of dried mycelia |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cordysinin B (CHEBI:69426) has functional parent adenosine (CHEBI:16335) |
| cordysinin B (CHEBI:69426) has role fungal metabolite (CHEBI:76946) |
| cordysinin B (CHEBI:69426) is a adenosines (CHEBI:22260) |
| cordysinin B (CHEBI:69426) is a ether (CHEBI:25698) |
| IUPAC Name |
|---|
| 2'-O-methyladenosine |
| Synonyms | Source |
|---|---|
| 2'-O-Me-A | ChEBI |
| (2R,3R,4R,5R)-5-(6-amino-9H-purin-9-yl)-2-(hydroxymethyl)-4-methoxytetrahydrofuran-3-ol | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| HMDB0004326 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:42301 | Reaxys |
| CAS:2140-79-6 | ChemIDplus |
| Citations |
|---|