EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H18N2O3 |
| Net Charge | 0 |
| Average Mass | 226.276 |
| Monoisotopic Mass | 226.13174 |
| SMILES | [H][C@@]12CC[C@@H](O)N1C(=O)[C@H](CC(C)C)NC2=O |
| InChI | InChI=1S/C11H18N2O3/c1-6(2)5-7-11(16)13-8(10(15)12-7)3-4-9(13)14/h6-9,14H,3-5H2,1-2H3,(H,12,15)/t7-,8-,9+/m0/s1 |
| InChIKey | HPHCHBVVCGFPNC-XHNCKOQMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cordyceps sinensis (ncbitaxon:72228) | mycelium (BTO:0001436) | PubMed (21848266) | Ethanolic extract of dried mycelia |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cordysinin A (CHEBI:69425) has role fungal metabolite (CHEBI:76946) |
| cordysinin A (CHEBI:69425) is a dipeptide (CHEBI:46761) |
| cordysinin A (CHEBI:69425) is a pyrrolopyrazine (CHEBI:48337) |
| IUPAC Name |
|---|
| (3S,6R,8aS)-6-hydroxy-3-(2-methylpropyl)hexahydropyrrolo[1,2-a]pyrazine-1,4-dione |
| Synonym | Source |
|---|---|
| cyclo(L-leucine-L-hydroxyproline) | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21902661 | Reaxys |
| Citations |
|---|