EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H30O4 |
| Net Charge | 0 |
| Average Mass | 286.412 |
| Monoisotopic Mass | 286.21441 |
| SMILES | COC(=O)/C(C)=C/C(C)CC(C)CC(C)(O)CC(C)O |
| InChI | InChI=1S/C16H30O4/c1-11(8-13(3)15(18)20-6)7-12(2)9-16(5,19)10-14(4)17/h8,11-12,14,17,19H,7,9-10H2,1-6H3/b13-8+ |
| InChIKey | IQQFJADQXWBZGX-MDWZMJQESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Actinopolyspora erythraea YIM 90600 (ncbitaxon:414996) | mycelium (BTO:0001436) | PubMed (21870828) | EtOAc extract of fermentation broth and Acetone extract of mycelia were together used |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| actinopolysporin B (CHEBI:69423) has role metabolite (CHEBI:25212) |
| actinopolysporin B (CHEBI:69423) is a monoterpenoid (CHEBI:25409) |
| Citations |
|---|