EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H28O4 |
| Net Charge | 0 |
| Average Mass | 272.385 |
| Monoisotopic Mass | 272.19876 |
| SMILES | COC(=O)/C(C)=C/C(C)CC(C)CC(C)(O)C(C)O |
| InChI | InChI=1S/C15H28O4/c1-10(8-12(3)14(17)19-6)7-11(2)9-15(5,18)13(4)16/h8,10-11,13,16,18H,7,9H2,1-6H3/b12-8+ |
| InChIKey | CKWFXHNQQBEUKJ-XYOKQWHBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Actinopolyspora erythraea YIM 90600 (ncbitaxon:414996) | mycelium (BTO:0001436) | PubMed (21870828) | EtOAc extract of fermentation broth and Acetone extract of mycelia were together used |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| actinopolysporin A (CHEBI:69422) has role metabolite (CHEBI:25212) |
| actinopolysporin A (CHEBI:69422) is a monoterpenoid (CHEBI:25409) |
| Citations |
|---|