EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H12Br2O4 |
| Net Charge | 0 |
| Average Mass | 404.054 |
| Monoisotopic Mass | 401.91023 |
| SMILES | Oc1cc(CCc2cc(O)c(O)c(Br)c2)cc(Br)c1O |
| InChI | InChI=1S/C14H12Br2O4/c15-9-3-7(5-11(17)13(9)19)1-2-8-4-10(16)14(20)12(18)6-8/h3-6,17-20H,1-2H2 |
| InChIKey | IFYFPCNWTZBOEQ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Polysiphonia urceolata (ncbitaxon:65404) | - | PubMed (21875052) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5,5'-(ethane-1,2-diyl)bis(3-bromobenzene-1,2-diol) (CHEBI:69421) has role metabolite (CHEBI:25212) |
| 5,5'-(ethane-1,2-diyl)bis(3-bromobenzene-1,2-diol) (CHEBI:69421) is a stilbenoid (CHEBI:26776) |
| Synonym | Source |
|---|---|
| 4,4'-(1,2-Ethanediyl)bis(6-bromo-1,2-benzenediol) | ChEBI |
| Citations |
|---|