EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H10Br2O4 |
| Net Charge | 0 |
| Average Mass | 402.038 |
| Monoisotopic Mass | 399.89458 |
| SMILES | Oc1cc2c(c(Br)c1O)-c1c(cc(O)c(O)c1Br)CC2 |
| InChI | InChI=1S/C14H10Br2O4/c15-11-9-5(3-7(17)13(11)19)1-2-6-4-8(18)14(20)12(16)10(6)9/h3-4,17-20H,1-2H2 |
| InChIKey | SYHMQWZYWWUQBA-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Melanothamnus ferulaceus (ncbitaxon:2509026) | - | PubMed (21875052) | Compound is stable atropisomers contain R configuration. Species also known as Polysiphonia ferulacea. |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Polysiphenol (CHEBI:69420) has role metabolite (CHEBI:25212) |
| Polysiphenol (CHEBI:69420) is a phenanthrenes (CHEBI:25961) |
| Synonym | Source |
|---|---|
| 4,5-Dibromo-9,10-dihydro-2,3,6,7-phenanthrenetetrol | ChEBI |
| Citations |
|---|