EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H20BrN5.2C2F3O2 |
| Net Charge | 0 |
| Average Mass | 588.303 |
| Monoisotopic Mass | 587.06029 |
| SMILES | NC(=[NH2+])NCCCCc1[nH+]ccc2c1nc1cc(Br)ccc12.O=C([O-])C(F)(F)F.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C16H18BrN5.2C2HF3O2/c17-10-4-5-11-12-6-8-20-13(15(12)22-14(11)9-10)3-1-2-7-21-16(18)19;2*3-2(4,5)1(6)7/h4-6,8-9,22H,1-3,7H2,(H4,18,19,21);2*(H,6,7) |
| InChIKey | DODWCDBOSMVLLQ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudodistoma opacum (WORMS:251228) | - | PubMed (21846091) | MeOH extract of frozen specimens |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| opacaline A (CHEBI:69417) has role metabolite (CHEBI:25212) |
| opacaline A (CHEBI:69417) is a organic molecular entity (CHEBI:50860) |
| Citations |
|---|