EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H31NO12 |
| Net Charge | 0 |
| Average Mass | 513.496 |
| Monoisotopic Mass | 513.18463 |
| SMILES | [H][C@]1([C@H](C)O)O[C@@H](Oc2ccc(/C=C(\C)C(=O)N[C@@H]3[C@H](O)[C@@H](O)[C@@]4([H])OCO[C@@]4([H])[C@@H]3O)cc2O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C23H31NO12/c1-8(22(32)24-13-14(27)16(29)21-20(15(13)28)33-7-34-21)5-10-3-4-12(11(26)6-10)35-23-18(31)17(30)19(36-23)9(2)25/h3-6,9,13-21,23,25-31H,7H2,1-2H3,(H,24,32)/b8-5+/t9-,13+,14-,15+,16+,17-,18-,19+,20-,21+,23+/m0/s1 |
| InChIKey | STCSTCYFNDYMLS-CXUMOKCHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces sp. (ncbitaxon:1931) | latex (BTO:0000710) | PubMed (21879726) | Previous component: resin; MeOH extract of cell mass and HP20 resin Strain: C34 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5''-dihydrohygromycin A (CHEBI:69415) has role metabolite (CHEBI:25212) |
| 5''-dihydrohygromycin A (CHEBI:69415) is a hydroxycinnamic acid (CHEBI:24689) |
| Synonym | Source |
|---|---|
| (E)-N-[(3aS,4R,5R,6S,7R,7aR)-4,6,7-trihydroxy-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-5-yl]-3-[4-[(2S,3S,4S,5R)-3,4-dihydroxy-5-[(1S)-1-hydroxyethyl]oxolan-2-yl]oxy-3-hydroxyphenyl]-2-methylprop-2-enamide | ChEBI |
| Citations |
|---|