EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H42O5 |
| Net Charge | 0 |
| Average Mass | 470.650 |
| Monoisotopic Mass | 470.30322 |
| SMILES | CC/C=C/[C@H]1C/C=C/C=C\[C@H](OC)[C@@H](O)[C@@H](O)[C@@H](C)/C=C/C[C@@H](C)/C=C/C=C(C)/C=C/C(=O)O1 |
| InChI | InChI=1S/C29H42O5/c1-6-7-17-25-18-9-8-10-19-26(33-5)29(32)28(31)24(4)16-12-15-22(2)13-11-14-23(3)20-21-27(30)34-25/h7-14,16-17,19-22,24-26,28-29,31-32H,6,15,18H2,1-5H3/b9-8+,13-11+,16-12+,17-7+,19-10-,21-20+,23-14+/t22-,24-,25-,26-,28-,29+/m0/s1 |
| InChIKey | YHRYKMQBQALRPC-NBRNKRCBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces sp. (ncbitaxon:1931) | latex (BTO:0000710) | PubMed (21879726) | Previous component: resin; MeOH extract of cell mass and HP20 resin Strain: C34 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chaxalactin C, rel- (CHEBI:69413) has role metabolite (CHEBI:25212) |
| chaxalactin C, rel- (CHEBI:69413) is a macrolide (CHEBI:25106) |
| Citations |
|---|