EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H40O5 |
| Net Charge | 0 |
| Average Mass | 456.623 |
| Monoisotopic Mass | 456.28757 |
| SMILES | CC/C=C/[C@H]1C/C=C/C=C\[C@H](O)[C@@H](O)[C@@H](O)[C@@H](C)/C=C/C[C@@H](C)/C=C/C=C(C)/C=C/C(=O)O1 |
| InChI | InChI=1S/C28H40O5/c1-5-6-16-24-17-8-7-9-18-25(29)28(32)27(31)23(4)15-11-14-21(2)12-10-13-22(3)19-20-26(30)33-24/h6-13,15-16,18-21,23-25,27-29,31-32H,5,14,17H2,1-4H3/b8-7+,12-10+,15-11+,16-6+,18-9-,20-19+,22-13+/t21-,23-,24-,25-,27-,28+/m0/s1 |
| InChIKey | OYPWVSHNWVXFOC-NUOKWNRSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces sp. (ncbitaxon:1931) | latex (BTO:0000710) | PubMed (21879726) | Previous component: resin; MeOH extract of cell mass and HP20 resin Strain: C34 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chaxalactin B, rel- (CHEBI:69412) has role metabolite (CHEBI:25212) |
| chaxalactin B, rel- (CHEBI:69412) is a macrolide (CHEBI:25106) |
| Citations |
|---|