EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H40O4 |
| Net Charge | 0 |
| Average Mass | 440.624 |
| Monoisotopic Mass | 440.29266 |
| SMILES | CC/C=C/[C@H]1C/C=C/C=C\[C@H](O)C[C@@H](O)[C@@H](C)/C=C/C[C@@H](C)/C=C/C=C(C)/C=C/C(=O)O1 |
| InChI | InChI=1S/C28H40O4/c1-5-6-17-26-18-9-7-8-16-25(29)21-27(30)24(4)15-11-14-22(2)12-10-13-23(3)19-20-28(31)32-26/h6-13,15-17,19-20,22,24-27,29-30H,5,14,18,21H2,1-4H3/b9-7+,12-10+,15-11+,16-8-,17-6+,20-19+,23-13+/t22-,24-,25-,26-,27+/m0/s1 |
| InChIKey | DDLYOXCLOXCDSG-GLJFNCHPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces sp. (ncbitaxon:1931) | latex (BTO:0000710) | PubMed (21879726) | Previous component: resin; MeOH extract of cell mass and HP20 resin Strain: C34 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chaxalactin A, (rel)- (CHEBI:69411) has role metabolite (CHEBI:25212) |
| chaxalactin A, (rel)- (CHEBI:69411) is a macrolide (CHEBI:25106) |
| Citations |
|---|