EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H26N2O3 |
| Net Charge | 0 |
| Average Mass | 354.450 |
| Monoisotopic Mass | 354.19434 |
| SMILES | [H][C@]12N3CCC[C@@]1([C@@H](C)O)CC(C(=O)OC)=C1Nc4ccccc4[C@@]12CC3 |
| InChI | InChI=1S/C21H26N2O3/c1-13(24)20-8-5-10-23-11-9-21(19(20)23)15-6-3-4-7-16(15)22-17(21)14(12-20)18(25)26-2/h3-4,6-7,13,19,22,24H,5,8-12H2,1-2H3/t13-,19+,20+,21+/m1/s1 |
| InChIKey | BKMGDPNQILJWLI-VLCNGCBASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Catharanthus roseus (ncbitaxon:4058) | - | Article (Kohl, W., Witte, B. and Hofle, G. (1981) Alkaloids from Catharanthus roseus tissue cultures, II. Z. Naturforsch, 86b, 1153-1162.) | |
| Catharanthus trichophyllus (ncbitaxon:319559) | - | DOI (10.1016/S0031-9422(00)98066-X) | Found in hairy root. |
| Stemmadenia tomentosa (IPNI:244360-2) | cell suspension culture (BTO:0000221) | Article (Stöckigt, J., Pawelka, K-H., Rother, A. and Deus, B. (1982) Indole alkaloids from cell suspension cultures of Stemmadenia tomentosa and Voacanga africana. Z. Naturforsch, 37c, 857-860.) | |
| Vinca minor (ncbitaxon:60093) | - | PubMed (13943964) | |
| Voacanga africana (ncbitaxon:141630) | cell suspension culture (BTO:0000221) | Article (Stöckigt, J., Pawelka, K-H., Rother, A. and Deus, B. (1982) Indole alkaloids from cell suspension cultures of Stemmadenia tomentosa and Voacanga africana. Z. Naturforsch, 37c, 857-860.) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-minovincinine (CHEBI:6941) has role plant metabolite (CHEBI:76924) |
| (−)-minovincinine (CHEBI:6941) is a Aspidosperma alkaloid (CHEBI:142772) |
| (−)-minovincinine (CHEBI:6941) is a alkaloid ester (CHEBI:38481) |
| (−)-minovincinine (CHEBI:6941) is a methyl ester (CHEBI:25248) |
| (−)-minovincinine (CHEBI:6941) is a monoterpenoid indole alkaloid (CHEBI:65323) |
| (−)-minovincinine (CHEBI:6941) is a organic heteropentacyclic compound (CHEBI:38164) |
| (−)-minovincinine (CHEBI:6941) is a secondary alcohol (CHEBI:35681) |
| (−)-minovincinine (CHEBI:6941) is a secondary amino compound (CHEBI:50995) |
| (−)-minovincinine (CHEBI:6941) is a tertiary amino compound (CHEBI:50996) |
| (−)-minovincinine (CHEBI:6941) is conjugate base of (−)-minovincinine(1+) (CHEBI:144373) |
| (−)-minovincinine (CHEBI:6941) is enantiomer of (+)-minovincinine (CHEBI:145195) |
| Incoming Relation(s) |
| (−)-minovincinine(1+) (CHEBI:144373) is conjugate acid of (−)-minovincinine (CHEBI:6941) |
| (+)-minovincinine (CHEBI:145195) is enantiomer of (−)-minovincinine (CHEBI:6941) |
| IUPAC Name |
|---|
| methyl (20R)-20-hydroxy-5α,12β,19α-2,3-didehydroaspidospermidine-3-carboxylate |
| Synonyms | Source |
|---|---|
| 19R-hydroxy-(−)-vincadifformine | ChEBI |
| (−)-19R-minovincinine | ChEBI |
| (−)-minovincinine | ChEBI |
| minovincinine | KEGG COMPOUND |
| Citations |
|---|