EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H12O4 |
| Net Charge | 0 |
| Average Mass | 244.246 |
| Monoisotopic Mass | 244.07356 |
| SMILES | COC(=O)c1coc(Cc2ccccc2)cc1=O |
| InChI | InChI=1S/C14H12O4/c1-17-14(16)12-9-18-11(8-13(12)15)7-10-5-3-2-4-6-10/h2-6,8-9H,7H2,1H3 |
| InChIKey | QTNLPWNQLKXVJK-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus sp. (ncbitaxon:5065) | - | PubMed (21854017) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-Carbomethoxy-6-benzyl-4-pyrone (CHEBI:69405) has role metabolite (CHEBI:25212) |
| 3-Carbomethoxy-6-benzyl-4-pyrone (CHEBI:69405) is a carbonyl compound (CHEBI:36586) |
| 3-Carbomethoxy-6-benzyl-4-pyrone (CHEBI:69405) is a pyrans (CHEBI:26407) |
| Citations |
|---|