EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H17NO6 |
| Net Charge | 0 |
| Average Mass | 343.335 |
| Monoisotopic Mass | 343.10559 |
| SMILES | C[C@@H](CC(=O)NC(=O)c1coc(Cc2ccccc2)cc1=O)C(=O)O |
| InChI | InChI=1S/C18H17NO6/c1-11(18(23)24)7-16(21)19-17(22)14-10-25-13(9-15(14)20)8-12-5-3-2-4-6-12/h2-6,9-11H,7-8H2,1H3,(H,23,24)(H,19,21,22)/t11-/m0/s1 |
| InChIKey | JBQPQUZBAGHRDN-NSHDSACASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus niger (ncbitaxon:5061) | - | PubMed (21854017) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pestalamide A (CHEBI:69404) has role Aspergillus metabolite (CHEBI:76956) |
| pestalamide A (CHEBI:69404) is a 4-pyranones (CHEBI:131906) |
| pestalamide A (CHEBI:69404) is a dicarboximide (CHEBI:35356) |
| pestalamide A (CHEBI:69404) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| (2S)-4-{[(6-benzyl-4-oxo-4H-pyran-3-yl)carbonyl]amino}-2-methyl-4-oxobutanoic acid |
| Synonyms | Source |
|---|---|
| 4-[(6-benzyl-3-hydroxy-6H-furo[2,3-b]pyrrol-4-yl)oxy]-2-methyl-4-oxobutyric acid | ChEBI |
| tensidol B | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19412737 | Reaxys |
| Citations |
|---|