EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H11NO3 |
| Net Charge | 0 |
| Average Mass | 229.235 |
| Monoisotopic Mass | 229.07389 |
| SMILES | NC(=O)c1coc(Cc2ccccc2)cc1=O |
| InChI | InChI=1S/C13H11NO3/c14-13(16)11-8-17-10(7-12(11)15)6-9-4-2-1-3-5-9/h1-5,7-8H,6H2,(H2,14,16) |
| InChIKey | RQWMGMIZGOCPMP-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus carbonarius (ncbitaxon:40993) | - | PubMed (21854017) | |
| Aspergillus niger (ncbitaxon:5061) | - | PubMed (21854017) |
| Roles Classification |
|---|
| Biological Role: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| carbonarone A (CHEBI:69403) has role Aspergillus metabolite (CHEBI:76956) |
| carbonarone A (CHEBI:69403) has role antineoplastic agent (CHEBI:35610) |
| carbonarone A (CHEBI:69403) is a 4-pyranones (CHEBI:131906) |
| carbonarone A (CHEBI:69403) is a monocarboxylic acid amide (CHEBI:29347) |
| IUPAC Name |
|---|
| 6-benzyl-4-oxo-4H-pyran-3-carboxamide |
| Synonyms | Source |
|---|---|
| carbonarone A | ChEBI |
| tensidol A | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19412735 | Reaxys |
| Citations |
|---|