EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O2 |
| Net Charge | 0 |
| Average Mass | 304.474 |
| Monoisotopic Mass | 304.24023 |
| SMILES | [H][C@]12CCC(C=C)=C(C)[C@]1([H])O[C@@H](O)C[C@@]1([H])C(C)(C)CCC[C@]21C |
| InChI | InChI=1S/C20H32O2/c1-6-14-8-9-15-18(13(14)2)22-17(21)12-16-19(3,4)10-7-11-20(15,16)5/h6,15-18,21H,1,7-12H2,2-5H3/t15-,16-,17+,18-,20+/m0/s1 |
| InChIKey | LYHHJTUWLMOJRZ-HBWRTXEVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Acacia jacquemontii (IPNI:470619-1) | - | PubMed (21894904) | |
| Acacia schaffneri (ncbitaxon:138041) | |||
| leaf (BTO:0000713) | PubMed (21894904) | n-hexane extract of air dried, ground flowers and leaves | |
| flower (BTO:0000469) | PubMed (21894904) | n-hexane extract of air dried, ground flowers and leaves |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (5S,7R, 8R,9R,10S)-(-)-7,8-seco-7,8-oxacassa-13,15-dien-7-ol (CHEBI:69397) has role metabolite (CHEBI:25212) |
| (5S,7R, 8R,9R,10S)-(-)-7,8-seco-7,8-oxacassa-13,15-dien-7-ol (CHEBI:69397) is a oxacycle (CHEBI:38104) |
| Citations |
|---|