EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H31NO7 |
| Net Charge | 0 |
| Average Mass | 421.490 |
| Monoisotopic Mass | 421.21005 |
| SMILES | [H][C@]12[C@H](C)/C(=C3/OC(=O)C(C)=C3OC)O[C@]13CCC[N+]1([O-])[C@@]2([H])[C@@H](CC[C@]1([H])[C@H](O)CC)O3 |
| InChI | InChI=1S/C22H31NO7/c1-5-14(24)13-7-8-15-17-16-11(2)19(20-18(27-4)12(3)21(25)28-20)30-22(16,29-15)9-6-10-23(13,17)26/h11,13-17,24H,5-10H2,1-4H3/b20-19-/t11-,13+,14+,15+,16+,17-,22+,23?/m0/s1 |
| InChIKey | GQHSQVDONZAQMO-LJNNQWQWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Stemona aphylla (ncbitaxon:492013) | - | PubMed (21902195) | Strain: HG 893 |
| Stemona (ncbitaxon:85281) | - | PubMed (21902195) | Unidentified species originated from locus classicus Strain: HG 943 |
| Stemona curtisii (ncbitaxon:492018) | |||
| root (BTO:0001188) | PubMed (21049906) | 95% EtOH extract of dry, ground roots | |
| - | PubMed (21049906) | Strain: HG 920 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Oxystemokerrine N-oxide (CHEBI:69394) has role metabolite (CHEBI:25212) |
| Oxystemokerrine N-oxide (CHEBI:69394) is a tertiary amine oxide (CHEBI:134363) |
| Citations |
|---|