EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H31NO5 |
| Net Charge | 0 |
| Average Mass | 389.492 |
| Monoisotopic Mass | 389.22022 |
| SMILES | [H][C@]1([C@H](O)CC)CCC[C@]2([H])N1CCC=C1O/C(=C3\OC(=O)C(C)=C3OC)[C@@H](C)[C@@]12[H] |
| InChI | InChI=1S/C22H31NO5/c1-5-16(24)14-8-6-9-15-18-12(2)20(27-17(18)10-7-11-23(14)15)21-19(26-4)13(3)22(25)28-21/h10,12,14-16,18,24H,5-9,11H2,1-4H3/b21-20-/t12-,14+,15-,16+,18+/m0/s1 |
| InChIKey | KLADGQYNEYECIT-LFVNKPDISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Stemona kerrii (ncbitaxon:564062) | |||
| rhizome (BTO:0001181) | PubMed (21902195) | MeOH extract of dried underground parts(tuberous roots and rhizomes) | |
| tuberous root (BTO:0001309) | PubMed (21902195) | MeOH extract of dried underground parts(tuberous roots and rhizomes) | |
| root (BTO:0001188) | PubMed (21049906) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| stemokerrine (CHEBI:69392) has role metabolite (CHEBI:25212) |
| stemokerrine (CHEBI:69392) is a citraconoyl group (CHEBI:23315) |
| Citations |
|---|