EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H25NO5 |
| Net Charge | 0 |
| Average Mass | 347.411 |
| Monoisotopic Mass | 347.17327 |
| SMILES | [H][C@]12[C@H](C)/C(=C3/OC(=O)C(C)=C3OC)O[C@]13CCCN1CCC[C@@H](O3)[C@]12[H] |
| InChI | InChI=1S/C19H25NO5/c1-10-13-14-12-6-4-8-20(14)9-5-7-19(13,24-12)25-16(10)17-15(22-3)11(2)18(21)23-17/h10,12-14H,4-9H2,1-3H3/b17-16-/t10-,12+,13+,14-,19+/m0/s1 |
| InChIKey | LXAQGNNSRKLTLE-GNFKBLLDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Stemona curtisii (ncbitaxon:492018) | |||
| rhizome (BTO:0001181) | PubMed (21902195) | MeOH extract of dried underground parts(tuberous roots and rhizomes) | |
| tuberous root (BTO:0001309) | PubMed (21902195) | MeOH extract of dried underground parts(tuberous roots and rhizomes) | |
| root (BTO:0001188) | PubMed (21049906) | 95% EtOH extract of dry, ground roots | |
| - | PubMed (21049906) | Strain: HG 920 | |
| Stemona aphylla (ncbitaxon:492013) | - | PubMed (21902195) | Strain: HG 915 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| stemocurtisine (CHEBI:69391) has role metabolite (CHEBI:25212) |
| stemocurtisine (CHEBI:69391) is a furofuran (CHEBI:47790) |
| Synonym | Source |
|---|---|
| 4-Methoxy-3-methyl-5-[(1R,9R,10R,11R,12S)-12-methyl-14,15-dioxa-5-azatetracyclo[7.5.1.0(1,11).0(5,10)]pentadec-13-ylidene]-2(5H)-furanone | ChEBI |
| Citations |
|---|