EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H31NO6 |
| Net Charge | 0 |
| Average Mass | 405.491 |
| Monoisotopic Mass | 405.21514 |
| SMILES | [H][C@]12[C@H](C)/C(=C3/OC(=O)C(C)=C3OC)O[C@]13CCCN1[C@]([H])([C@@H](O)CC)CC[C@@H](O3)[C@]12[H] |
| InChI | InChI=1S/C22H31NO6/c1-5-14(24)13-7-8-15-17-16-11(2)19(20-18(26-4)12(3)21(25)27-20)29-22(16,28-15)9-6-10-23(13)17/h11,13-17,24H,5-10H2,1-4H3/b20-19-/t11-,13-,14-,15+,16+,17-,22+/m0/s1 |
| InChIKey | WAULTDWQPCNZBI-SBKNPRMJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Stemona curtisii (ncbitaxon:492018) | |||
| tuberous root (BTO:0001309) | PubMed (21902195) | MeOH extract of dried underground parts(tuberous roots and rhizomes) | |
| rhizome (BTO:0001181) | PubMed (21902195) | MeOH extract of dried underground parts(tuberous roots and rhizomes) | |
| root (BTO:0001188) | PubMed (21049906) | 95% EtOH extract of dry, ground roots | |
| - | PubMed (21049906) | Strain: HG 920 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| stemocurtisinol (CHEBI:69389) has role metabolite (CHEBI:25212) |
| stemocurtisinol (CHEBI:69389) is a citraconoyl group (CHEBI:23315) |
| Citations |
|---|