EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:69387 - protostemonine
| Formula | C23H31NO6 |
| Net Charge | 0 |
| Average Mass | 417.502 |
| Monoisotopic Mass | 417.21514 |
| SMILES | [H][C@]12[C@H](C)/C(=C3/OC(=O)C(C)=C3OC)O[C@]1([H])CCCN1[C@@]2([H])CC[C@@]1([H])[C@]1([H])C[C@H](C)C(=O)O1 |
| InChI | InChI=1S/C23H31NO6/c1-11-10-17(29-22(11)25)14-7-8-15-18-12(2)20(28-16(18)6-5-9-24(14)15)21-19(27-4)13(3)23(26)30-21/h11-12,14-18H,5-10H2,1-4H3/b21-20-/t11-,12-,14-,15-,16+,17-,18+/m0/s1 |
| InChIKey | JDGNFRYDHRYXNL-ROHJGGRPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Stemona (ncbitaxon:85281) | |||
| - | PubMed (21902195) | Strain: HG 884 | |
| - | PubMed (21902195) | Strain: HG 943 | |
| Stemona aphylla (ncbitaxon:492013) | |||
| tuberous root (BTO:0001309) | PubMed (21902195) | MeOH extract of dried underground parts(tuberous roots and rhizomes) | |
| rhizome (BTO:0001181) | PubMed (21902195) | MeOH extract of dried underground parts(tuberous roots and rhizomes) | |
| Stemona pierrei (IPNI:821994-1) | |||
| rhizome (BTO:0001181) | PubMed (21902195) | MeOH extract of dried underground parts(tuberous roots and rhizomes) | |
| tuberous root (BTO:0001309) | PubMed (21902195) | MeOH extract of dried underground parts(tuberous roots and rhizomes) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| protostemonine (CHEBI:69387) has role metabolite (CHEBI:25212) |
| protostemonine (CHEBI:69387) is a alkaloid (CHEBI:22315) |
| Citations |
|---|