EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H34O4 |
| Net Charge | 0 |
| Average Mass | 374.521 |
| Monoisotopic Mass | 374.24571 |
| SMILES | [H][C@@]12C[C@]([H])([C@]3([H])C[C@H](C)C(=O)O3)C3CCCC[C@]([H])([C@@H](CC)[C@]4([H])OC(=O)[C@@H](C)[C@]14[H])[C@@]32[H] |
| InChI | InChI=1S/C23H34O4/c1-4-13-14-7-5-6-8-15-16(18-9-11(2)22(24)26-18)10-17(20(14)15)19-12(3)23(25)27-21(13)19/h11-21H,4-10H2,1-3H3/t11-,12-,13+,14+,15?,16-,17+,18-,19+,20-,21-/m0/s1 |
| InChIKey | VLCNUQYQHZUOOD-GFITZGPESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Stemona phyllantha (ncbitaxon:492017) | |||
| tuberous root (BTO:0001309) | PubMed (21902195) | MeOH extract of dried underground parts(tuberous roots and rhizomes) | |
| rhizome (BTO:0001181) | PubMed (21902195) | MeOH extract of dried underground parts(tuberous roots and rhizomes) | |
| Stemona tuberosa (ncbitaxon:167572) | |||
| rhizome (BTO:0001181) | PubMed (21902195) | MeOH extract of dried underground parts(tuberous roots and rhizomes) | |
| tuberous root (BTO:0001309) | PubMed (21902195) | MeOH extract of dried underground parts(tuberous roots and rhizomes) | |
| Stemona sessilifolia (ncbitaxon:339784) | root (BTO:0001188) | PubMed (21902195) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tuberostemonine A (CHEBI:69384) has role metabolite (CHEBI:25212) |
| tuberostemonine A (CHEBI:69384) is a terpene lactone (CHEBI:37668) |
| Citations |
|---|