EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H29NO5 |
| Net Charge | 0 |
| Average Mass | 387.476 |
| Monoisotopic Mass | 387.20457 |
| SMILES | [H][C@@]12CCN3[C@]1(CCCC)[C@]1([H])C[C@@]3([H])[C@@]3([H])[C@H](C)/C(=C4/OC(=O)C(C)=C4OC)O[C@]23O1 |
| InChI | InChI=1S/C22H29NO5/c1-5-6-8-21-14-7-9-23(21)13-10-15(21)27-22(14)16(13)11(2)18(28-22)19-17(25-4)12(3)20(24)26-19/h11,13-16H,5-10H2,1-4H3/b19-18-/t11-,13-,14+,15-,16+,21?,22+/m0/s1 |
| InChIKey | DTVYAHOULQCSMS-WFDNSANHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Stemona (ncbitaxon:85281) | |||
| - | PubMed (21902195) | Strain: HG 884 | |
| - | PubMed (21902195) | Unidentified species originated from locus classicus Strain: HG 943 | |
| Stemona aphylla (ncbitaxon:492013) | root (BTO:0001188) | PubMed (21126060) | 95% Ethanolic extract of ground, dried roots |
| Stemona cochinchinensis (IPNI:821984-1) | - | PubMed (21902195) | |
| Stemona collinsiae (ncbitaxon:492015) | |||
| tuberous root (BTO:0001309) | PubMed (21902195) | MeOH extract of dried underground parts(tuberous roots and rhizomes) | |
| rhizome (BTO:0001181) | PubMed (21902195) | MeOH extract of dried underground parts(tuberous roots and rhizomes) | |
| Stemona curtisii (ncbitaxon:492018) | |||
| root (BTO:0001188) | PubMed (21049906) | 95% EtOH extract of dry, ground roots | |
| rhizome (BTO:0001181) | PubMed (21902195) | MeOH extract of dried underground parts(tuberous roots and rhizomes) | |
| tuberous root (BTO:0001309) | PubMed (21902195) | MeOH extract of dried underground parts(tuberous roots and rhizomes) | |
| Stemona japonica (ncbitaxon:85282) | leaf (BTO:0000713) | PubMed (21902195) | |
| Stemona javanica (ncbitaxon:244042) | - | PubMed (21902195) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| stemofoline (CHEBI:69380) has role metabolite (CHEBI:25212) |
| stemofoline (CHEBI:69380) is a alkaloid (CHEBI:22315) |
| Synonym | Source |
|---|---|
| 2(5H)-Furanone, 5-((2S,2aR,6S,7aS,7bS,8R,9S)-7b-butylhexahydro-9-methyl-4H-2,2,6-(epoxy(1)propanyl(3)ylidene)furo(2,3,4-gh)pyrrolizin-10-ylidene)-4-methoxy-3-methyl-, (5Z)- | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:29881-57-0 | ChemIDplus |
| Citations |
|---|