EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H38O18 |
| Net Charge | 0 |
| Average Mass | 710.638 |
| Monoisotopic Mass | 710.20581 |
| SMILES | [H][C@@]1(O[C@H]2[C@H](Oc3c(-c4ccc(O)cc4)oc4cc(O[C@@H]5O[C@@H](C)[C@H](O)[C@@H](O)[C@H]5O)cc(O)c4c3=O)OC[C@H](O)[C@@H]2O)O[C@@H](C)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C32H38O18/c1-10-19(36)23(40)25(42)30(45-10)47-14-7-15(34)18-17(8-14)48-27(12-3-5-13(33)6-4-12)28(22(18)39)49-32-29(21(38)16(35)9-44-32)50-31-26(43)24(41)20(37)11(2)46-31/h3-8,10-11,16,19-21,23-26,29-38,40-43H,9H2,1-2H3/t10-,11-,16-,19-,20-,21-,23+,24+,25+,26+,29+,30-,31-,32-/m0/s1 |
| InChIKey | WNEKTAXRNDLFBT-UOFFBVERSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Anthyllis hermanniae (ncbitaxon:181246) | whole plant (BTO:0001461) | PubMed (21861458) | Methanolic extract of air dried and powdered plant |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hermannioside B (CHEBI:69378) has functional parent kaempferol (CHEBI:28499) |
| hermannioside B (CHEBI:69378) has role metabolite (CHEBI:25212) |
| hermannioside B (CHEBI:69378) has role plant metabolite (CHEBI:76924) |
| hermannioside B (CHEBI:69378) is a dihydroxyflavone (CHEBI:38686) |
| hermannioside B (CHEBI:69378) is a glycosyloxyflavone (CHEBI:50018) |
| hermannioside B (CHEBI:69378) is a α-L-arabinopyranoside (CHEBI:37782) |
| hermannioside B (CHEBI:69378) is a α-L-rhamnoside (CHEBI:27848) |
| IUPAC Name |
|---|
| 3-{[2-O-(6-deoxy-α-L-mannopyranosyl)-α-L-arabinopyranosyl]oxy}-5-hydroxy-2-(4-hydroxyphenyl)-4-oxo-4H-chromen-7-yl 6-deoxy-α-L-mannopyranoside |
| Synonym | Source |
|---|---|
| kaempferol 3-O-[α-L-rhamnopyranosyl-(1→2)-α-L-arabinopyranoside]-7-O-α-L-rhamnopyranoside | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21897854 | Reaxys |
| Citations |
|---|