EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H50O7 |
| Net Charge | 0 |
| Average Mass | 534.734 |
| Monoisotopic Mass | 534.35565 |
| SMILES | [H][C@]12CC=C3[C@]4([H])C[C@](C)(CO)CC[C@]4(C(=O)O)CC[C@@]3(C)[C@]1(C)CC[C@@]([H])(C(C)(O)CO)[C@]2(C)CCC(=O)OC |
| InChI | InChI=1S/C31H50O7/c1-26(18-32)13-15-31(25(35)36)16-14-28(3)20(21(31)17-26)7-8-22-27(2,11-10-24(34)38-6)23(30(5,37)19-33)9-12-29(22,28)4/h7,21-23,32-33,37H,8-19H2,1-6H3,(H,35,36)/t21-,22+,23+,26+,27+,28+,29+,30?,31-/m0/s1 |
| InChIKey | SUUYXWGSSHWCRR-RIFYGRPCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Kalopanax pictus (ncbitaxon:46399) | stem (BTO:0001300) | PubMed (21870831) | Previous component: stem bark; Hot MeOH extract of dried stem bark |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyl 4,23,29-trihydroxy-3,4-seco-olean-12-en-3-oate-28-oic acid (CHEBI:69364) has role anti-inflammatory agent (CHEBI:67079) |
| methyl 4,23,29-trihydroxy-3,4-seco-olean-12-en-3-oate-28-oic acid (CHEBI:69364) has role metabolite (CHEBI:25212) |
| methyl 4,23,29-trihydroxy-3,4-seco-olean-12-en-3-oate-28-oic acid (CHEBI:69364) has role plant metabolite (CHEBI:76924) |
| methyl 4,23,29-trihydroxy-3,4-seco-olean-12-en-3-oate-28-oic acid (CHEBI:69364) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| methyl 4,23,29-trihydroxy-3,4-seco-olean-12-en-3-oate-28-oic acid (CHEBI:69364) is a methyl ester (CHEBI:25248) |
| methyl 4,23,29-trihydroxy-3,4-seco-olean-12-en-3-oate-28-oic acid (CHEBI:69364) is a tetracyclic triterpenoid (CHEBI:26893) |
| IUPAC Name |
|---|
| (1R,2R,4aR,4bS,6aR,9R,10aS,12aR)-2-(1,2-dihydroxypropan-2-yl)-9-(hydroxymethyl)-1-(3-methoxy-3-oxopropyl)-1,4a,4b,9-tetramethyl-1,3,4,4a,4b,5,6,7,8,9,10,10a,12,12a-tetradecahydrochrysene-6a(2H)-carboxylic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21902578 | Reaxys |
| Citations |
|---|