EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H46O6 |
| Net Charge | 0 |
| Average Mass | 502.692 |
| Monoisotopic Mass | 502.32944 |
| SMILES | [H][C@]12CC=C3[C@]4([H])C[C@](C)(CO)CC[C@]4(C(=O)O)[C@H](O)C[C@@]3(C)[C@]1(C)CC[C@]1([H])[C@]2(C)CCC(=O)[C@@]1(C)CO |
| InChI | InChI=1S/C30H46O6/c1-25(16-31)12-13-30(24(35)36)19(14-25)18-6-7-21-26(2)10-9-22(33)27(3,17-32)20(26)8-11-28(21,4)29(18,5)15-23(30)34/h6,19-21,23,31-32,34H,7-17H2,1-5H3,(H,35,36)/t19-,20+,21+,23+,25+,26-,27-,28+,29+,30+/m0/s1 |
| InChIKey | XRUBFYYNZLBFBN-JYGFFPNFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Kalopanax pictus (ncbitaxon:46399) | stem (BTO:0001300) | PubMed (21870831) | Previous component: stem bark; Hot MeOH extract of dried stem bark |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 16,23,29-trihydroxy-3-oxo-olean-12-en-28-oic acid (CHEBI:69363) has parent hydride oleanane (CHEBI:36481) |
| 16,23,29-trihydroxy-3-oxo-olean-12-en-28-oic acid (CHEBI:69363) has role anti-inflammatory agent (CHEBI:67079) |
| 16,23,29-trihydroxy-3-oxo-olean-12-en-28-oic acid (CHEBI:69363) has role plant metabolite (CHEBI:76924) |
| 16,23,29-trihydroxy-3-oxo-olean-12-en-28-oic acid (CHEBI:69363) is a cyclic terpene ketone (CHEBI:36130) |
| 16,23,29-trihydroxy-3-oxo-olean-12-en-28-oic acid (CHEBI:69363) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| 16,23,29-trihydroxy-3-oxo-olean-12-en-28-oic acid (CHEBI:69363) is a pentacyclic triterpenoid (CHEBI:25872) |
| IUPAC Name |
|---|
| (16α)-16,23,29-trihydroxy-3-oxoolean-12-en-28-oic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21902579 | Reaxys |
| Citations |
|---|