EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H40O7 |
| Net Charge | 0 |
| Average Mass | 464.599 |
| Monoisotopic Mass | 464.27740 |
| SMILES | [H][C@]12O[C@]([H])(CC(=C)[C@@H](OC(C)=O)CC[C@@]1(C)OC(=O)CCC)[C@@]1([H])[C@@](C)(O)[C@@]3([H])C[C@]([H])([C@@H](C)CO3)[C@@]21[H] |
| InChI | InChI=1S/C26H40O7/c1-7-8-21(28)33-25(5)10-9-18(31-16(4)27)14(2)11-19-23-22(24(25)32-19)17-12-20(26(23,6)29)30-13-15(17)3/h15,17-20,22-24,29H,2,7-13H2,1,3-6H3/t15-,17+,18-,19+,20+,22+,23+,24+,25+,26-/m0/s1 |
| InChIKey | CAXUZJKWMCTHMI-UDQIIJQESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cladiella krempfi (WORMS:209611) | - | PubMed (21861494) | Acetone extract of Frozen specimens |
| Tritoniopsis elegans (ncbitaxon:152756) | |||
| gland (BTO:0000522) | PubMed (21861494) | Acetone extract of mantle and glands and Tritoniopsis elegans found grazing on Cladiella krempfi | |
| mantle (BTO:0000825) | PubMed (21861494) | Acetone extract of mantle and glands and Tritoniopsis elegans found grazing on Cladiella krempfi |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Tritoniopsin D (CHEBI:69362) has role metabolite (CHEBI:25212) |
| Tritoniopsin D (CHEBI:69362) is a butyrate ester (CHEBI:50477) |
| Tritoniopsin D (CHEBI:69362) is a oxanes (CHEBI:46942) |
| Synonym | Source |
|---|---|
| (1R,2R,3R,4R,7R,8R,9S,10R,13S,16R)-13-Acetoxy-8-hydroxy-4,8,16-trimethyl-12-methylene-6,17-dioxatetracyclo[8.6.1.1(3,7).0(2,9)]octadec-16-yl butyrate | ChEBI |
| Citations |
|---|