EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H54O6 |
| Net Charge | 0 |
| Average Mass | 570.811 |
| Monoisotopic Mass | 570.39204 |
| SMILES | [H][C@]12CC[C@]34C[C@]3(CC[C@@]4([H])[C@]3([H])C[C@]([H])([C@]4([H])OC4(C)C)OC3O)[C@]1(C)[C@H](O)C[C@@]1([H])C(C)(C)[C@H](OC(=O)C=C(C)C)CC[C@]21C |
| InChI | InChI=1S/C35H54O6/c1-19(2)15-27(37)40-26-11-12-32(7)23-10-13-34-18-35(34,33(23,8)25(36)17-24(32)30(26,3)4)14-9-21(34)20-16-22(39-29(20)38)28-31(5,6)41-28/h15,20-26,28-29,36,38H,9-14,16-18H2,1-8H3/t20-,21-,22+,23+,24-,25+,26+,28-,29?,32+,33-,34+,35+/m0/s1 |
| InChIKey | ITVZPGUBVVWDLH-YPEKPQOMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aegle marmelos (ncbitaxon:68527) | bark (BTO:0001301) | PubMed (21875114) | CH2Cl2-MeOH(1:1) extract of dried plant material(bark) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| skimmiarepin C (CHEBI:69358) has role metabolite (CHEBI:25212) |
| skimmiarepin C (CHEBI:69358) is a limonoid (CHEBI:39434) |
| Citations |
|---|