EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24O3 |
| Net Charge | 0 |
| Average Mass | 252.354 |
| Monoisotopic Mass | 252.17254 |
| SMILES | [H][C@]12C=C(CO)CC[C@@]1([H])[C@@H](C)CC[C@]2([H])[C@@H](C)C(=O)O |
| InChI | InChI=1S/C15H24O3/c1-9-3-5-13(10(2)15(17)18)14-7-11(8-16)4-6-12(9)14/h7,9-10,12-14,16H,3-6,8H2,1-2H3,(H,17,18)/t9-,10+,12-,13+,14-/m0/s1 |
| InChIKey | JTUOWRWJSXCKMC-DKUYFVBVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Eremophila mitchellii (IPNI:585196-1) | leaf (BTO:0000713) | PubMed (21877688) | n-Hexane,Methylene dichloride and methanolic extarct of airdried and ground leaves |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mitchellene E (CHEBI:69353) has role plant metabolite (CHEBI:76924) |
| mitchellene E (CHEBI:69353) is a carbobicyclic compound (CHEBI:36785) |
| mitchellene E (CHEBI:69353) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| mitchellene E (CHEBI:69353) is a octahydronaphthalenes (CHEBI:138397) |
| mitchellene E (CHEBI:69353) is a sesquiterpenoid (CHEBI:26658) |
| IUPAC Name |
|---|
| rel-(2R)-2-[(1S,4S,4aS,8aS)-7-(hydroxymethyl)-4-methyl-1,2,3,4,4a,5,6,8a-octahydronaphthalen-1-yl]propanoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21902564 | Reaxys |
| Citations |
|---|