EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H20O2 |
| Net Charge | 0 |
| Average Mass | 232.323 |
| Monoisotopic Mass | 232.14633 |
| SMILES | [H][C@@]12C3=CC[C@@]4([H])[C@@H](C)CC[C@]([H])([C@@H](C)[C@@]1([H])OC3=O)[C@@]24[H] |
| InChI | InChI=1S/C15H20O2/c1-7-3-4-10-8(2)14-13-11(15(16)17-14)6-5-9(7)12(10)13/h6-10,12-14H,3-5H2,1-2H3/t7-,8+,9-,10+,12-,13-,14+/m0/s1 |
| InChIKey | BFNUVKSKPNBQRT-IGLSZRPSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Eremophila mitchellii (IPNI:585196-1) | leaf (BTO:0000713) | PubMed (21877688) | n-Hexane,Methylene dichloride and methanolic extarct of airdried and ground leaves |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mitchellene B (CHEBI:69350) has role plant metabolite (CHEBI:76924) |
| mitchellene B (CHEBI:69350) is a organic heterotetracyclic compound (CHEBI:38163) |
| mitchellene B (CHEBI:69350) is a sesquiterpene lactone (CHEBI:37667) |
| IUPAC Name |
|---|
| (4aS,5S,7aS,8R,8aR,8bR,8cS)-5,8-dimethyl-4,4a,5,6,7,7a,8,8a,8b,8c-decahydro-2H-acenaphtho[1,8-bc]furan-2-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21902562 | Reaxys |
| Citations |
|---|