EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H20O3 |
| Net Charge | 0 |
| Average Mass | 248.322 |
| Monoisotopic Mass | 248.14124 |
| SMILES | [H][C@]12CC=C3C(=O)O[C@]4([H])[C@H](C)[C@@]([H])(CC[C@@]1(C)O)[C@@]2([H])[C@]34[H] |
| InChI | InChI=1S/C15H20O3/c1-7-8-5-6-15(2,17)10-4-3-9-12(11(8)10)13(7)18-14(9)16/h3,7-8,10-13,17H,4-6H2,1-2H3/t7-,8-,10-,11-,12+,13-,15-/m1/s1 |
| InChIKey | FPWZOYNGIYQUAS-AYTANIIVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Eremophila mitchellii (IPNI:585196-1) | leaf (BTO:0000713) | PubMed (21877688) | n-Hexane,Methylene dichloride and methanolic extarct of airdried and ground leaves |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mitchellene A (CHEBI:69349) has role plant metabolite (CHEBI:76924) |
| mitchellene A (CHEBI:69349) is a organic heterotetracyclic compound (CHEBI:38163) |
| mitchellene A (CHEBI:69349) is a sesquiterpene lactone (CHEBI:37667) |
| mitchellene A (CHEBI:69349) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| rel-(4aR,5R,7aS,8R,8aR,8bR,8cS)-5-hydroxy-5,8-dimethyl-4,4a,5,6,7,7a,8,8a,8b,8c-decahydro-2H-acenaphtho[1,8-bc]furan-2-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21902565 | Reaxys |
| Citations |
|---|