EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H20O3 |
| Net Charge | 0 |
| Average Mass | 248.322 |
| Monoisotopic Mass | 248.14124 |
| SMILES | [H][C@@]12C[C@]3([H])C(=C)C(=O)O[C@@]3([H])C=C(C)[C@]1([H])CC[C@]2(C)O |
| InChI | InChI=1S/C15H20O3/c1-8-6-13-11(9(2)14(16)18-13)7-12-10(8)4-5-15(12,3)17/h6,10-13,17H,2,4-5,7H2,1,3H3/t10-,11+,12+,13-,15-/m0/s1 |
| InChIKey | APMKESKZWHNIDJ-PFFFPCNUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Inula hupehensis (IPNI:225932-1) | aerial part (BTO:0001658) | PubMed (21894898) | 95% aqueous EtOH extract of dried and powdered aerial parts |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-epiisoinuviscolide (CHEBI:69347) has role anti-inflammatory agent (CHEBI:67079) |
| 4-epiisoinuviscolide (CHEBI:69347) has role metabolite (CHEBI:25212) |
| 4-epiisoinuviscolide (CHEBI:69347) has role plant metabolite (CHEBI:76924) |
| 4-epiisoinuviscolide (CHEBI:69347) is a organic heterotricyclic compound (CHEBI:26979) |
| 4-epiisoinuviscolide (CHEBI:69347) is a sesquiterpene lactone (CHEBI:37667) |
| 4-epiisoinuviscolide (CHEBI:69347) is a tertiary alcohol (CHEBI:26878) |
| 4-epiisoinuviscolide (CHEBI:69347) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (3aR,4aR,5S,7aR,9aS)-5-hydroxy-5,8-dimethyl-3-methylidene-3a,4,4a,5,6,7,7a,9a-octahydroazuleno[6,5-b]furan-2(3H)-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6512286 | Reaxys |
| Citations |
|---|