EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H26O7 |
| Net Charge | 0 |
| Average Mass | 366.410 |
| Monoisotopic Mass | 366.16785 |
| SMILES | [H][C@]12[C@H](C)C[C@]3([H])OC(=O)C(=C)[C@@]3([H])[C@H](O)[C@]1(C)[C@@H](OC(C)=O)C[C@@H]2OC(C)=O |
| InChI | InChI=1S/C19H26O7/c1-8-6-12-15(9(2)18(23)26-12)17(22)19(5)14(25-11(4)21)7-13(16(8)19)24-10(3)20/h8,12-17,22H,2,6-7H2,1,3-5H3/t8-,12+,13+,14+,15-,16-,17+,19-/m1/s1 |
| InChIKey | QFJNAUKGMNMIGV-IZZBGLMFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Inula hupehensis (IPNI:225932-1) | aerial part (BTO:0001658) | PubMed (21894898) | 95% aqueous EtOH extract of dried and powdered aerial parts |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| inuchinenolide C (CHEBI:69346) has role anti-inflammatory agent (CHEBI:67079) |
| inuchinenolide C (CHEBI:69346) has role metabolite (CHEBI:25212) |
| inuchinenolide C (CHEBI:69346) has role plant metabolite (CHEBI:76924) |
| inuchinenolide C (CHEBI:69346) is a acetate ester (CHEBI:47622) |
| inuchinenolide C (CHEBI:69346) is a organic heterotricyclic compound (CHEBI:26979) |
| inuchinenolide C (CHEBI:69346) is a secondary alcohol (CHEBI:35681) |
| inuchinenolide C (CHEBI:69346) is a sesquiterpene lactone (CHEBI:37667) |
| inuchinenolide C (CHEBI:69346) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (3aS,4S,4aR,5S,7S,7aS,8R,9aS)-4-hydroxy-4a,8-dimethyl-3-methylidene-2-oxododecahydroazuleno[6,5-b]furan-5,7-diyl diacetate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4823238 | Reaxys |
| Citations |
|---|