EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H22O5 |
| Net Charge | 0 |
| Average Mass | 306.358 |
| Monoisotopic Mass | 306.14672 |
| SMILES | [H][C@@]12CCC(=O)[C@@]1(C)[C@@H](OC(C)=O)[C@]1([H])C(=C)C(=O)O[C@@]1([H])C[C@H]2C |
| InChI | InChI=1S/C17H22O5/c1-8-7-12-14(9(2)16(20)22-12)15(21-10(3)18)17(4)11(8)5-6-13(17)19/h8,11-12,14-15H,2,5-7H2,1,3-4H3/t8-,11+,12+,14-,15+,17+/m1/s1 |
| InChIKey | JCDZXDWMCKMXFF-MMLVVLEOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Inula hupehensis (IPNI:225932-1) | aerial part (BTO:0001658) | PubMed (21894898) | 95% aqueous EtOH extract of dried and powdered aerial parts |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. NF-kappaB inhibitor An inhibitor of NF-κB (nuclear factor κ-light-chain-enhancer of activated B cells), a protein complex involved in the transcription of DNA. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ergolide (CHEBI:69340) has role anti-inflammatory agent (CHEBI:67079) |
| ergolide (CHEBI:69340) has role antineoplastic agent (CHEBI:35610) |
| ergolide (CHEBI:69340) has role metabolite (CHEBI:25212) |
| ergolide (CHEBI:69340) has role NF-κB inhibitor (CHEBI:73240) |
| ergolide (CHEBI:69340) has role plant metabolite (CHEBI:76924) |
| ergolide (CHEBI:69340) is a acetate ester (CHEBI:47622) |
| ergolide (CHEBI:69340) is a cyclic ketone (CHEBI:3992) |
| ergolide (CHEBI:69340) is a organic heterotricyclic compound (CHEBI:26979) |
| ergolide (CHEBI:69340) is a sesquiterpene lactone (CHEBI:37667) |
| ergolide (CHEBI:69340) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (3aR,4S,4aR,7aS,8R,9aS)-4a,8-dimethyl-3-methylidene-2,5-dioxododecahydroazuleno[6,5-b]furan-4-yl acetate |
| Synonym | Source |
|---|---|
| (3aR)-(3aα,4α,4aβ,7aα,8α,9aβ)-4-(acetyloxy)decahydro-4a,8-dimethyl-3-methylene-azuleno(6,5-b)furan-2,5-dione | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7142244 | Reaxys |
| CAS:54999-07-4 | ChemIDplus |
| Citations |
|---|