EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H22O5 |
| Net Charge | 0 |
| Average Mass | 306.358 |
| Monoisotopic Mass | 306.14672 |
| SMILES | [H][C@@]12CCC(=O)[C@@]1(C)[C@@H](OC(C)=O)[C@]1([H])C(=C)C(=O)O[C@@]1([H])C[C@H]2C |
| InChI | InChI=1S/C17H22O5/c1-8-7-12-14(9(2)16(20)22-12)15(21-10(3)18)17(4)11(8)5-6-13(17)19/h8,11-12,14-15H,2,5-7H2,1,3-4H3/t8-,11+,12+,14-,15+,17+/m1/s1 |
| InChIKey | JCDZXDWMCKMXFF-MMLVVLEOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Inula hupehensis (IPNI:225932-1) | aerial part (BTO:0001658) | PubMed (21894898) | 95% aqueous EtOH extract of dried and powdered aerial parts |
| Roles Classification |
|---|
| Biological Roles: | NF-kappaB inhibitor An inhibitor of NF-κB (nuclear factor κ-light-chain-enhancer of activated B cells), a protein complex involved in the transcription of DNA. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ergolide (CHEBI:69340) has role anti-inflammatory agent (CHEBI:67079) |
| ergolide (CHEBI:69340) has role antineoplastic agent (CHEBI:35610) |
| ergolide (CHEBI:69340) has role metabolite (CHEBI:25212) |
| ergolide (CHEBI:69340) has role NF-κB inhibitor (CHEBI:73240) |
| ergolide (CHEBI:69340) has role plant metabolite (CHEBI:76924) |
| ergolide (CHEBI:69340) is a acetate ester (CHEBI:47622) |
| ergolide (CHEBI:69340) is a cyclic ketone (CHEBI:3992) |
| ergolide (CHEBI:69340) is a organic heterotricyclic compound (CHEBI:26979) |
| ergolide (CHEBI:69340) is a sesquiterpene lactone (CHEBI:37667) |
| ergolide (CHEBI:69340) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (3aR,4S,4aR,7aS,8R,9aS)-4a,8-dimethyl-3-methylidene-2,5-dioxododecahydroazuleno[6,5-b]furan-4-yl acetate |
| Synonym | Source |
|---|---|
| (3aR)-(3aα,4α,4aβ,7aα,8α,9aβ)-4-(acetyloxy)decahydro-4a,8-dimethyl-3-methylene-azuleno(6,5-b)furan-2,5-dione | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7142244 | Reaxys |
| CAS:54999-07-4 | ChemIDplus |
| Citations |
|---|