EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H20O3 |
| Net Charge | 0 |
| Average Mass | 248.322 |
| Monoisotopic Mass | 248.14124 |
| SMILES | [H][C@@]12CCC(=O)[C@@]1(C)C[C@]1([H])C(=C)C(=O)O[C@@]1([H])C[C@H]2C |
| InChI | InChI=1S/C15H20O3/c1-8-6-12-10(9(2)14(17)18-12)7-15(3)11(8)4-5-13(15)16/h8,10-12H,2,4-7H2,1,3H3/t8-,10-,11+,12+,15+/m1/s1 |
| InChIKey | DCKYPAZZUYXYTC-SCGWIAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Inula hupehensis (IPNI:225932-1) | aerial part (BTO:0001658) | PubMed (21894898) | 95% aqueous EtOH extract of dried and powdered aerial parts |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| graveolide (CHEBI:69338) has role anti-inflammatory agent (CHEBI:67079) |
| graveolide (CHEBI:69338) has role metabolite (CHEBI:25212) |
| graveolide (CHEBI:69338) has role plant metabolite (CHEBI:76924) |
| graveolide (CHEBI:69338) is a cyclic ketone (CHEBI:3992) |
| graveolide (CHEBI:69338) is a organic heterotricyclic compound (CHEBI:26979) |
| graveolide (CHEBI:69338) is a sesquiterpene lactone (CHEBI:37667) |
| graveolide (CHEBI:69338) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (3aR,4aS,7aS,8R,9aS)-4a,8-dimethyl-3-methylidenedecahydroazuleno[6,5-b]furan-2,5-dione |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4785233 | Reaxys |
| Citations |
|---|