EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H20O5 |
| Net Charge | 0 |
| Average Mass | 304.342 |
| Monoisotopic Mass | 304.13107 |
| SMILES | [H][C@@]12C=CC(=O)[C@@]1(C)[C@@H](OC(C)=O)[C@]1([H])C(=C)C(=O)O[C@@]1([H])C[C@H]2C |
| InChI | InChI=1S/C17H20O5/c1-8-7-12-14(9(2)16(20)22-12)15(21-10(3)18)17(4)11(8)5-6-13(17)19/h5-6,8,11-12,14-15H,2,7H2,1,3-4H3/t8-,11+,12+,14-,15+,17+/m1/s1 |
| InChIKey | DCNRYQODUSSOKC-MMLVVLEOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Inula hupehensis (IPNI:225932-1) | aerial part (BTO:0001658) | PubMed (21894898) | 95% aqueous EtOH extract of dried and powdered aerial parts |
| Roles Classification |
|---|
| Biological Roles: | immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bigelovin (CHEBI:69337) has role antineoplastic agent (CHEBI:35610) |
| bigelovin (CHEBI:69337) has role apoptosis inducer (CHEBI:68495) |
| bigelovin (CHEBI:69337) has role immunomodulator (CHEBI:50846) |
| bigelovin (CHEBI:69337) has role plant metabolite (CHEBI:76924) |
| bigelovin (CHEBI:69337) is a acetate ester (CHEBI:47622) |
| bigelovin (CHEBI:69337) is a cyclic ketone (CHEBI:3992) |
| bigelovin (CHEBI:69337) is a organic heterotricyclic compound (CHEBI:26979) |
| bigelovin (CHEBI:69337) is a sesquiterpene lactone (CHEBI:37667) |
| bigelovin (CHEBI:69337) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (3aR,4S,4aR,7aR,8R,9aS)-4a,8-dimethyl-3-methylidene-2,5-dioxo-2,3,3a,4,4a,5,7a,8,9,9a-decahydroazuleno[6,5-b]furan-4-yl acetate |
| Synonym | Source |
|---|---|
| 6α,8α-dihydroxy-4-oxo-ambrosa-2,11(13)-dien-12-oic acid-12,8-lactone acetate | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1295049 | Reaxys |
| CAS:3668-14-2 | ChemIDplus |
| Citations |
|---|