EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H20O4 |
| Net Charge | 0 |
| Average Mass | 264.321 |
| Monoisotopic Mass | 264.13616 |
| SMILES | [H][C@]12C[C@@](C)(O)C3=CC[C@](C)(O)[C@]3([H])C[C@]1([H])C(=C)C(=O)O2 |
| InChI | InChI=1S/C15H20O4/c1-8-9-6-11-10(4-5-14(11,2)17)15(3,18)7-12(9)19-13(8)16/h4,9,11-12,17-18H,1,5-7H2,2-3H3/t9-,11-,12+,14+,15-/m1/s1 |
| InChIKey | SKXYOUKPVUIPFP-HTZLXXLYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Inula hupehensis (IPNI:225932-1) | aerial part (BTO:0001658) | PubMed (21894898) | 95% aqueous EtOH extract of dried and powdered aerial parts |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4β,10α-dihydroxy-5αH-guai-1(2),11(13)-dien-12,8α-olide (CHEBI:69333) has role anti-inflammatory agent (CHEBI:67079) |
| 4β,10α-dihydroxy-5αH-guai-1(2),11(13)-dien-12,8α-olide (CHEBI:69333) has role metabolite (CHEBI:25212) |
| 4β,10α-dihydroxy-5αH-guai-1(2),11(13)-dien-12,8α-olide (CHEBI:69333) has role plant metabolite (CHEBI:76924) |
| 4β,10α-dihydroxy-5αH-guai-1(2),11(13)-dien-12,8α-olide (CHEBI:69333) is a guaiane sesquiterpenoid (CHEBI:36744) |
| 4β,10α-dihydroxy-5αH-guai-1(2),11(13)-dien-12,8α-olide (CHEBI:69333) is a organic heterotricyclic compound (CHEBI:26979) |
| 4β,10α-dihydroxy-5αH-guai-1(2),11(13)-dien-12,8α-olide (CHEBI:69333) is a tertiary alcohol (CHEBI:26878) |
| 4β,10α-dihydroxy-5αH-guai-1(2),11(13)-dien-12,8α-olide (CHEBI:69333) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (3aR,4aR,5S,8R,9aS)-5,8-dihydroxy-5,8-dimethyl-3-methylidene-3a,4,4a,5,6,8,9,9a-octahydroazuleno[6,5-b]furan-2(3H)-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21902555 | Reaxys |
| Citations |
|---|