EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H24O5 |
| Net Charge | 0 |
| Average Mass | 308.374 |
| Monoisotopic Mass | 308.16237 |
| SMILES | [H][C@]12[C@H](C)C[C@]3([H])OC(=O)C(=C)[C@@]3([H])[C@H](O)[C@]1(C)C(=O)C[C@H]2OCC |
| InChI | InChI=1S/C17H24O5/c1-5-21-11-7-12(18)17(4)14(11)8(2)6-10-13(15(17)19)9(3)16(20)22-10/h8,10-11,13-15,19H,3,5-7H2,1-2,4H3/t8-,10+,11-,13-,14-,15+,17-/m1/s1 |
| InChIKey | YXYLQALWYQEJAY-LAMAJPJRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Inula hupehensis (IPNI:225932-1) | aerial part (BTO:0001658) | PubMed (21894898) | 95% aqueous EtOH extract of dried and powdered aerial parts |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1S,2R,5R,6S,7S,8S,10R)-6-hydroxy-2-ethoxy-4-oxopseudoguai-11(13)-en-12,8-olide (CHEBI:69329) has role anti-inflammatory agent (CHEBI:67079) |
| (1S,2R,5R,6S,7S,8S,10R)-6-hydroxy-2-ethoxy-4-oxopseudoguai-11(13)-en-12,8-olide (CHEBI:69329) has role plant metabolite (CHEBI:76924) |
| (1S,2R,5R,6S,7S,8S,10R)-6-hydroxy-2-ethoxy-4-oxopseudoguai-11(13)-en-12,8-olide (CHEBI:69329) is a cyclic ketone (CHEBI:3992) |
| (1S,2R,5R,6S,7S,8S,10R)-6-hydroxy-2-ethoxy-4-oxopseudoguai-11(13)-en-12,8-olide (CHEBI:69329) is a ether (CHEBI:25698) |
| (1S,2R,5R,6S,7S,8S,10R)-6-hydroxy-2-ethoxy-4-oxopseudoguai-11(13)-en-12,8-olide (CHEBI:69329) is a organic heterotricyclic compound (CHEBI:26979) |
| (1S,2R,5R,6S,7S,8S,10R)-6-hydroxy-2-ethoxy-4-oxopseudoguai-11(13)-en-12,8-olide (CHEBI:69329) is a pseudoguaianolide (CHEBI:76704) |
| (1S,2R,5R,6S,7S,8S,10R)-6-hydroxy-2-ethoxy-4-oxopseudoguai-11(13)-en-12,8-olide (CHEBI:69329) is a secondary alcohol (CHEBI:35681) |
| (1S,2R,5R,6S,7S,8S,10R)-6-hydroxy-2-ethoxy-4-oxopseudoguai-11(13)-en-12,8-olide (CHEBI:69329) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (3aS,4S,4aR,7R,7aS,8R,9aS)-7-ethoxy-4-hydroxy-4a,8-dimethyl-3-methylidenedecahydroazuleno[6,5-b]furan-2,5-dione |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21902556 | Reaxys |
| Citations |
|---|