EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H48O2 |
| Net Charge | 0 |
| Average Mass | 428.701 |
| Monoisotopic Mass | 428.36543 |
| SMILES | [H][C@@]12C[C@@H](O)C3=CC(=O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1([H])[C@H](C)CC[C@@H](CC)C(C)C |
| InChI | InChI=1S/C29H48O2/c1-7-20(18(2)3)9-8-19(4)23-10-11-24-22-17-27(31)26-16-21(30)12-14-29(26,6)25(22)13-15-28(23,24)5/h16,18-20,22-25,27,31H,7-15,17H2,1-6H3/t19-,20-,22+,23-,24+,25+,27-,28-,29-/m1/s1 |
| InChIKey | IWNCBADONFSAAW-NFVQQQKOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Beilschmiedia tsangii (IPNI:462970-1) | root (BTO:0001188) | PubMed (21846089) | Cold MeOH extract of dry and sliced roots |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6beta-hydroxystigmast-4-en-3-one (CHEBI:69321) has parent hydride stigmastane (CHEBI:26773) |
| 6beta-hydroxystigmast-4-en-3-one (CHEBI:69321) has role metabolite (CHEBI:25212) |
| 6beta-hydroxystigmast-4-en-3-one (CHEBI:69321) is a steroid (CHEBI:35341) |
| Citations |
|---|